C12H13N3O — CID 168699726
4-(4-amino-2-oxopyrrolidin-1-yl)-2-methylbenzonitrile (PubChem CID 168699726) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 4-(4-amino-2-oxopyrrolidin-1-yl)-2-methylbenzonitrile.
| Compound Name | 4-(4-amino-2-oxopyrrolidin-1-yl)-2-methylbenzonitrile |
|---|---|
| PubChem CID | 168699726 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4-(4-amino-2-oxopyrrolidin-1-yl)-2-methylbenzonitrile |
| SMILES | Cc1cc(N2CC(N)CC2=O)ccc1C#N |
| InChI | InChI=1S/C12H13N3O/c1-8-4-11(3-2-9(8)6-13)15-7-10(14)5-12(15)16/h2-4,10H,5,7,14H2,1H3 |
| InChIKey | FJOCLFWOURSNDR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 70.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |