C12H17ClN2O — CID 71779044
4-amino-1-(3,4-dimethylphenyl)pyrrolidin-2-one;hydrochloride (PubChem CID 71779044) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 4-amino-1-(3,4-dimethylphenyl)pyrrolidin-2-one;hydrochloride.
| Compound Name | 4-amino-1-(3,4-dimethylphenyl)pyrrolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 71779044 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-amino-1-(3,4-dimethylphenyl)pyrrolidin-2-one;hydrochloride |
| SMILES | Cc1ccc(N2CC(N)CC2=O)cc1C.Cl |
| InChI | InChI=1S/C12H16N2O.ClH/c1-8-3-4-11(5-9(8)2)14-7-10(13)6-12(14)15;/h3-5,10H,6-7,13H2,1-2H3;1H |
| InChIKey | XGUZQQJVZXQWDY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |