C11H10Cl3NO — CID 168508820
4-(chloromethyl)-1-(3,4-dichlorophenyl)pyrrolidin-2-one (PubChem CID 168508820) has the molecular formula C11H10Cl3NO and a molecular weight of 278.57 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(3,4-dichlorophenyl)pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-(3,4-dichlorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168508820 |
| Molecular Formula | C11H10Cl3NO |
| Molecular Weight | 278.57 g/mol |
| Exact Mass | 276.98 |
| IUPAC Name | 4-(chloromethyl)-1-(3,4-dichlorophenyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CCl)CN1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H10Cl3NO/c12-5-7-3-11(16)15(6-7)8-1-2-9(13)10(14)4-8/h1-2,4,7H,3,5-6H2 |
| InChIKey | MWHSFWSSYFLNRM-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|