C18H15Cl2NO4 — CID 10045310
4-[[1-(3,4-dichlorophenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoic acid (PubChem CID 10045310) has the molecular formula C18H15Cl2NO4 and a molecular weight of 380.23 g/mol. Its IUPAC name is 4-[[1-(3,4-dichlorophenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoic acid.
| Compound Name | 4-[[1-(3,4-dichlorophenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 10045310 |
| Molecular Formula | C18H15Cl2NO4 |
| Molecular Weight | 380.23 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 4-[[1-(3,4-dichlorophenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoic acid |
| SMILES | O=C(O)c1ccc(OCC2CC(=O)N(c3ccc(Cl)c(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C18H15Cl2NO4/c19-15-6-3-13(8-16(15)20)21-9-11(7-17(21)22)10-25-14-4-1-12(2-5-14)18(23)24/h1-6,8,11H,7,9-10H2,(H,23,24) |
| InChIKey | JXDXGNUQLBPYPT-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |