C23H27NO4 — CID 10407483
methyl 4-[[1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoate (PubChem CID 10407483) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is methyl 4-[[1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoate.
| Compound Name | methyl 4-[[1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 10407483 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | methyl 4-[[1-(4-tert-butylphenyl)-5-oxopyrrolidin-3-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC2CC(=O)N(c3ccc(C(C)(C)C)cc3)C2)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-23(2,3)18-7-9-19(10-8-18)24-14-16(13-21(24)25)15-28-20-11-5-17(6-12-20)22(26)27-4/h5-12,16H,13-15H2,1-4H3 |
| InChIKey | JVTZOQMDKZFRBJ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |