C13H15NO4 — CID 83726248
methyl 4-[4-(hydroxymethyl)-2-oxopyrrolidin-1-yl]benzoate (PubChem CID 83726248) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is methyl 4-[4-(hydroxymethyl)-2-oxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[4-(hydroxymethyl)-2-oxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 83726248 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl 4-[4-(hydroxymethyl)-2-oxopyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CC(CO)CC2=O)cc1 |
| InChI | InChI=1S/C13H15NO4/c1-18-13(17)10-2-4-11(5-3-10)14-7-9(8-15)6-12(14)16/h2-5,9,15H,6-8H2,1H3 |
| InChIKey | OIOQUENXPZHPLB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |