C11H11ClFNOS — CID 168671508
1-(4-chloro-3-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671508) has the molecular formula C11H11ClFNOS and a molecular weight of 259.73 g/mol. Its IUPAC name is 1-(4-chloro-3-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(4-chloro-3-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671508 |
| Molecular Formula | C11H11ClFNOS |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | 1-(4-chloro-3-fluorophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C11H11ClFNOS/c12-9-2-1-8(4-10(9)13)14-5-7(6-16)3-11(14)15/h1-2,4,7,16H,3,5-6H2 |
| InChIKey | IWBFJAYKOCUOGM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|