C11H10F3NOS — CID 168671314
4-(sulfanylmethyl)-1-(2,4,6-trifluorophenyl)pyrrolidin-2-one (PubChem CID 168671314) has the molecular formula C11H10F3NOS and a molecular weight of 261.27 g/mol. Its IUPAC name is 4-(sulfanylmethyl)-1-(2,4,6-trifluorophenyl)pyrrolidin-2-one.
| Compound Name | 4-(sulfanylmethyl)-1-(2,4,6-trifluorophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671314 |
| Molecular Formula | C11H10F3NOS |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 4-(sulfanylmethyl)-1-(2,4,6-trifluorophenyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H10F3NOS/c12-7-2-8(13)11(9(14)3-7)15-4-6(5-17)1-10(15)16/h2-3,6,17H,1,4-5H2 |
| InChIKey | HLOOYCYLZHBJEI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|