C11H11F2IN2O — CID 168660507
4-(aminomethyl)-1-(2,6-difluoro-4-iodophenyl)pyrrolidin-2-one (PubChem CID 168660507) has the molecular formula C11H11F2IN2O and a molecular weight of 352.12 g/mol. Its IUPAC name is 4-(aminomethyl)-1-(2,6-difluoro-4-iodophenyl)pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-(2,6-difluoro-4-iodophenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168660507 |
| Molecular Formula | C11H11F2IN2O |
| Molecular Weight | 352.12 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 4-(aminomethyl)-1-(2,6-difluoro-4-iodophenyl)pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2c(F)cc(I)cc2F)C1 |
| InChI | InChI=1S/C11H11F2IN2O/c12-8-2-7(14)3-9(13)11(8)16-5-6(4-15)1-10(16)17/h2-3,6H,1,4-5,15H2 |
| InChIKey | NOWPSOVSNHAFNZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.12 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|