C10H9Cl2F2N3O — CID 168660467
4-(aminomethyl)-1-(3,5-dichloro-2,6-difluoro-4-pyridinyl)pyrrolidin-2-one (PubChem CID 168660467) has the molecular formula C10H9Cl2F2N3O and a molecular weight of 296.10 g/mol. Its IUPAC name is 4-(aminomethyl)-1-(3,5-dichloro-2,6-difluoro-4-pyridinyl)pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-(3,5-dichloro-2,6-difluoro-4-pyridinyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168660467 |
| Molecular Formula | C10H9Cl2F2N3O |
| Molecular Weight | 296.10 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 4-(aminomethyl)-1-(3,5-dichloro-2,6-difluoro-4-pyridinyl)pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2c(Cl)c(F)nc(F)c2Cl)C1 |
| InChI | InChI=1S/C10H9Cl2F2N3O/c11-6-8(7(12)10(14)16-9(6)13)17-3-4(2-15)1-5(17)18/h4H,1-3,15H2 |
| InChIKey | KOMXXOKJHNMGOK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.10 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|