C10H11Cl2N3O — CID 168660485
4-(aminomethyl)-1-(2,4-dichloro-3-pyridinyl)pyrrolidin-2-one (PubChem CID 168660485) has the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. Its IUPAC name is 4-(aminomethyl)-1-(2,4-dichloro-3-pyridinyl)pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-(2,4-dichloro-3-pyridinyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168660485 |
| Molecular Formula | C10H11Cl2N3O |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 4-(aminomethyl)-1-(2,4-dichloro-3-pyridinyl)pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2c(Cl)ccnc2Cl)C1 |
| InChI | InChI=1S/C10H11Cl2N3O/c11-7-1-2-14-10(12)9(7)15-5-6(4-13)3-8(15)16/h1-2,6H,3-5,13H2 |
| InChIKey | FJTASFIEIOBOEF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|