C10H11BrClN3O — CID 168661090
4-(aminomethyl)-1-(5-bromo-2-chloro-3-pyridinyl)pyrrolidin-2-one (PubChem CID 168661090) has the molecular formula C10H11BrClN3O and a molecular weight of 304.57 g/mol. Its IUPAC name is 4-(aminomethyl)-1-(5-bromo-2-chloro-3-pyridinyl)pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-(5-bromo-2-chloro-3-pyridinyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168661090 |
| Molecular Formula | C10H11BrClN3O |
| Molecular Weight | 304.57 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 4-(aminomethyl)-1-(5-bromo-2-chloro-3-pyridinyl)pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2cc(Br)cnc2Cl)C1 |
| InChI | InChI=1S/C10H11BrClN3O/c11-7-2-8(10(12)14-4-7)15-5-6(3-13)1-9(15)16/h2,4,6H,1,3,5,13H2 |
| InChIKey | HFQZBPOSJQWLDK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.57 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|