C10H11BrFN3O — CID 168660978
4-(aminomethyl)-1-(3-bromo-5-fluoro-2-pyridinyl)pyrrolidin-2-one (PubChem CID 168660978) has the molecular formula C10H11BrFN3O and a molecular weight of 288.12 g/mol. Its IUPAC name is 4-(aminomethyl)-1-(3-bromo-5-fluoro-2-pyridinyl)pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-(3-bromo-5-fluoro-2-pyridinyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168660978 |
| Molecular Formula | C10H11BrFN3O |
| Molecular Weight | 288.12 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | 4-(aminomethyl)-1-(3-bromo-5-fluoro-2-pyridinyl)pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2ncc(F)cc2Br)C1 |
| InChI | InChI=1S/C10H11BrFN3O/c11-8-2-7(12)4-14-10(8)15-5-6(3-13)1-9(15)16/h2,4,6H,1,3,5,13H2 |
| InChIKey | DNJOCLZQRCBGGF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.12 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |