C10H10BrF3N4O — CID 168660952
4-(aminomethyl)-1-[5-bromo-4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-2-one (PubChem CID 168660952) has the molecular formula C10H10BrF3N4O and a molecular weight of 339.12 g/mol. Its IUPAC name is 4-(aminomethyl)-1-[5-bromo-4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-[5-bromo-4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168660952 |
| Molecular Formula | C10H10BrF3N4O |
| Molecular Weight | 339.12 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 4-(aminomethyl)-1-[5-bromo-4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2ncc(Br)c(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C10H10BrF3N4O/c11-6-3-16-9(17-8(6)10(12,13)14)18-4-5(2-15)1-7(18)19/h3,5H,1-2,4,15H2 |
| InChIKey | CVJBRWFNRMTJBI-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.12 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |