C12H12BrF3N2O2 — CID 168660842
4-(aminomethyl)-1-[2-bromo-4-(trifluoromethoxy)phenyl]pyrrolidin-2-one (PubChem CID 168660842) has the molecular formula C12H12BrF3N2O2 and a molecular weight of 353.14 g/mol. Its IUPAC name is 4-(aminomethyl)-1-[2-bromo-4-(trifluoromethoxy)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-[2-bromo-4-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168660842 |
| Molecular Formula | C12H12BrF3N2O2 |
| Molecular Weight | 353.14 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 4-(aminomethyl)-1-[2-bromo-4-(trifluoromethoxy)phenyl]pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2ccc(OC(F)(F)F)cc2Br)C1 |
| InChI | InChI=1S/C12H12BrF3N2O2/c13-9-4-8(20-12(14,15)16)1-2-10(9)18-6-7(5-17)3-11(18)19/h1-2,4,7H,3,5-6,17H2 |
| InChIKey | GBWZYKQEZYUXIQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.14 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |