C12H12F4N2O — CID 168660629
4-(aminomethyl)-1-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolidin-2-one (PubChem CID 168660629) has the molecular formula C12H12F4N2O and a molecular weight of 276.23 g/mol. Its IUPAC name is 4-(aminomethyl)-1-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168660629 |
| Molecular Formula | C12H12F4N2O |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 4-(aminomethyl)-1-[4-fluoro-2-(trifluoromethyl)phenyl]pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2ccc(F)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C12H12F4N2O/c13-8-1-2-10(9(4-8)12(14,15)16)18-6-7(5-17)3-11(18)19/h1-2,4,7H,3,5-6,17H2 |
| InChIKey | HBCSVOSURAXLLZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |