C12H10ClF4NO3S — CID 168676964
[1-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676964) has the molecular formula C12H10ClF4NO3S and a molecular weight of 359.73 g/mol. Its IUPAC name is [1-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676964 |
| Molecular Formula | C12H10ClF4NO3S |
| Molecular Weight | 359.73 g/mol |
| Exact Mass | 359.00 |
| IUPAC Name | [1-[4-chloro-2-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1ccc(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C12H10ClF4NO3S/c13-8-1-2-10(9(4-8)12(14,15)16)18-5-7(3-11(18)19)6-22(17,20)21/h1-2,4,7H,3,5-6H2 |
| InChIKey | VADCHWORQAEMRG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.73 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |