C13H10F4N2O3S — CID 168677180
[1-[2-cyano-4-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168677180) has the molecular formula C13H10F4N2O3S and a molecular weight of 350.29 g/mol. Its IUPAC name is [1-[2-cyano-4-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-[2-cyano-4-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168677180 |
| Molecular Formula | C13H10F4N2O3S |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | [1-[2-cyano-4-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | N#Cc1cc(C(F)(F)F)ccc1N1CC(CS(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C13H10F4N2O3S/c14-13(15,16)10-1-2-11(9(4-10)5-18)19-6-8(3-12(19)20)7-23(17,21)22/h1-2,4,8H,3,6-7H2 |
| InChIKey | NMNBQVHFMJQFDY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |