C12H10Cl2N2O3S — CID 168674147
[1-(4-chloro-2-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168674147) has the molecular formula C12H10Cl2N2O3S and a molecular weight of 333.20 g/mol. Its IUPAC name is [1-(4-chloro-2-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(4-chloro-2-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168674147 |
| Molecular Formula | C12H10Cl2N2O3S |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 331.98 |
| IUPAC Name | [1-(4-chloro-2-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | N#Cc1cc(Cl)ccc1N1CC(CS(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C12H10Cl2N2O3S/c13-10-1-2-11(9(4-10)5-15)16-6-8(3-12(16)17)7-20(14,18)19/h1-2,4,8H,3,6-7H2 |
| InChIKey | DOIBPGZUGBBOQD-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |