C11H9Cl4NO3S — CID 168673880
[5-oxo-1-(2,4,5-trichlorophenyl)pyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673880) has the molecular formula C11H9Cl4NO3S and a molecular weight of 377.08 g/mol. Its IUPAC name is [5-oxo-1-(2,4,5-trichlorophenyl)pyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [5-oxo-1-(2,4,5-trichlorophenyl)pyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673880 |
| Molecular Formula | C11H9Cl4NO3S |
| Molecular Weight | 377.08 g/mol |
| Exact Mass | 374.91 |
| IUPAC Name | [5-oxo-1-(2,4,5-trichlorophenyl)pyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C11H9Cl4NO3S/c12-7-2-9(14)10(3-8(7)13)16-4-6(1-11(16)17)5-20(15,18)19/h2-3,6H,1,4-5H2 |
| InChIKey | YILLVFXCNKIYOO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.08 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|