C11H10Cl2FNO3S — CID 168673991
[1-(2-chloro-5-fluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673991) has the molecular formula C11H10Cl2FNO3S and a molecular weight of 326.18 g/mol. Its IUPAC name is [1-(2-chloro-5-fluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(2-chloro-5-fluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673991 |
| Molecular Formula | C11H10Cl2FNO3S |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | [1-(2-chloro-5-fluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1c1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H10Cl2FNO3S/c12-9-2-1-8(14)4-10(9)15-5-7(3-11(15)16)6-19(13,17)18/h1-2,4,7H,3,5-6H2 |
| InChIKey | MDHJWGOLPPQBAV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |