C11H12F2N2O3S — CID 168682427
[1-(2,5-difluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682427) has the molecular formula C11H12F2N2O3S and a molecular weight of 290.29 g/mol. Its IUPAC name is [1-(2,5-difluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(2,5-difluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682427 |
| Molecular Formula | C11H12F2N2O3S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | [1-(2,5-difluorophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2cc(F)ccc2F)C1 |
| InChI | InChI=1S/C11H12F2N2O3S/c12-8-1-2-9(13)10(4-8)15-5-7(3-11(15)16)6-19(14,17)18/h1-2,4,7H,3,5-6H2,(H2,14,17,18) |
| InChIKey | DHDFJOUNIAWGBY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |