C11H11F2IN2O3S — CID 168682389
[1-(4,5-difluoro-2-iodophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682389) has the molecular formula C11H11F2IN2O3S and a molecular weight of 416.19 g/mol. Its IUPAC name is [1-(4,5-difluoro-2-iodophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(4,5-difluoro-2-iodophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682389 |
| Molecular Formula | C11H11F2IN2O3S |
| Molecular Weight | 416.19 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | [1-(4,5-difluoro-2-iodophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2cc(F)c(F)cc2I)C1 |
| InChI | InChI=1S/C11H11F2IN2O3S/c12-7-2-9(14)10(3-8(7)13)16-4-6(1-11(16)17)5-20(15,18)19/h2-3,6H,1,4-5H2,(H2,15,18,19) |
| InChIKey | WZOQAJKMSLCKJX-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|