C11H10Cl2INO3S — CID 168674043
[1-(4-chloro-3-iodophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168674043) has the molecular formula C11H10Cl2INO3S and a molecular weight of 434.08 g/mol. Its IUPAC name is [1-(4-chloro-3-iodophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(4-chloro-3-iodophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168674043 |
| Molecular Formula | C11H10Cl2INO3S |
| Molecular Weight | 434.08 g/mol |
| Exact Mass | 432.88 |
| IUPAC Name | [1-(4-chloro-3-iodophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1c1ccc(Cl)c(I)c1 |
| InChI | InChI=1S/C11H10Cl2INO3S/c12-9-2-1-8(4-10(9)14)15-5-7(3-11(15)16)6-19(13,17)18/h1-2,4,7H,3,5-6H2 |
| InChIKey | OAQQEUOHPAMXBV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.08 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|