C11H10Cl2N2O5S — CID 168674046
[1-(4-chloro-3-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168674046) has the molecular formula C11H10Cl2N2O5S and a molecular weight of 353.18 g/mol. Its IUPAC name is [1-(4-chloro-3-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(4-chloro-3-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168674046 |
| Molecular Formula | C11H10Cl2N2O5S |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | [1-(4-chloro-3-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H10Cl2N2O5S/c12-9-2-1-8(4-10(9)15(17)18)14-5-7(3-11(14)16)6-21(13,19)20/h1-2,4,7H,3,5-6H2 |
| InChIKey | RTXWONFCNUKSAR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|