C12H13FN2O6S — CID 168675707
[1-(4-methoxy-3-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168675707) has the molecular formula C12H13FN2O6S and a molecular weight of 332.31 g/mol. Its IUPAC name is [1-(4-methoxy-3-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(4-methoxy-3-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168675707 |
| Molecular Formula | C12H13FN2O6S |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | [1-(4-methoxy-3-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | COc1ccc(N2CC(CS(=O)(=O)F)CC2=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H13FN2O6S/c1-21-11-3-2-9(5-10(11)15(17)18)14-6-8(4-12(14)16)7-22(13,19)20/h2-3,5,8H,4,6-7H2,1H3 |
| InChIKey | QOIMMQGJHHQZSC-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|