C12H13ClINO4S — CID 168673111
[1-(3-iodo-4-methoxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673111) has the molecular formula C12H13ClINO4S and a molecular weight of 429.66 g/mol. Its IUPAC name is [1-(3-iodo-4-methoxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(3-iodo-4-methoxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673111 |
| Molecular Formula | C12H13ClINO4S |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 428.93 |
| IUPAC Name | [1-(3-iodo-4-methoxyphenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | COc1ccc(N2CC(CS(=O)(=O)Cl)CC2=O)cc1I |
| InChI | InChI=1S/C12H13ClINO4S/c1-19-11-3-2-9(5-10(11)14)15-6-8(4-12(15)16)7-20(13,17)18/h2-3,5,8H,4,6-7H2,1H3 |
| InChIKey | PVIKESAERCWPAK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|