C12H10BrClF3NO4S — CID 168674011
[1-[3-bromo-4-(trifluoromethoxy)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168674011) has the molecular formula C12H10BrClF3NO4S and a molecular weight of 436.63 g/mol. Its IUPAC name is [1-[3-bromo-4-(trifluoromethoxy)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-[3-bromo-4-(trifluoromethoxy)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168674011 |
| Molecular Formula | C12H10BrClF3NO4S |
| Molecular Weight | 436.63 g/mol |
| Exact Mass | 434.92 |
| IUPAC Name | [1-[3-bromo-4-(trifluoromethoxy)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | O=C1CC(CS(=O)(=O)Cl)CN1c1ccc(OC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C12H10BrClF3NO4S/c13-9-4-8(1-2-10(9)22-12(15,16)17)18-5-7(3-11(18)19)6-23(14,20)21/h1-2,4,7H,3,5-6H2 |
| InChIKey | AUAQFUZCODXJFX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.63 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |