C13H15F3N2O4S — CID 168681139
[1-[4-methoxy-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168681139) has the molecular formula C13H15F3N2O4S and a molecular weight of 352.33 g/mol. Its IUPAC name is [1-[4-methoxy-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-[4-methoxy-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168681139 |
| Molecular Formula | C13H15F3N2O4S |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | [1-[4-methoxy-3-(trifluoromethyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | COc1ccc(N2CC(CS(N)(=O)=O)CC2=O)cc1C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O4S/c1-22-11-3-2-9(5-10(11)13(14,15)16)18-6-8(4-12(18)19)7-23(17,20)21/h2-3,5,8H,4,6-7H2,1H3,(H2,17,20,21) |
| InChIKey | PFZBARBRXTUPJG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |