C12H13F3N2O3S2 — CID 168683188
[5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-3-yl]methanesulfonamide (PubChem CID 168683188) has the molecular formula C12H13F3N2O3S2 and a molecular weight of 354.38 g/mol. Its IUPAC name is [5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168683188 |
| Molecular Formula | C12H13F3N2O3S2 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | [5-oxo-1-[3-(trifluoromethylsulfanyl)phenyl]pyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2cccc(SC(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H13F3N2O3S2/c13-12(14,15)21-10-3-1-2-9(5-10)17-6-8(4-11(17)18)7-22(16,19)20/h1-3,5,8H,4,6-7H2,(H2,16,19,20) |
| InChIKey | HEVLBDUXSZGVPD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |