C17H25N3O3S — CID 168683137
[5-oxo-1-[3-(piperidin-1-ylmethyl)phenyl]pyrrolidin-3-yl]methanesulfonamide (PubChem CID 168683137) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is [5-oxo-1-[3-(piperidin-1-ylmethyl)phenyl]pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [5-oxo-1-[3-(piperidin-1-ylmethyl)phenyl]pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168683137 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | [5-oxo-1-[3-(piperidin-1-ylmethyl)phenyl]pyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2cccc(CN3CCCCC3)c2)C1 |
| InChI | InChI=1S/C17H25N3O3S/c18-24(22,23)13-15-10-17(21)20(12-15)16-6-4-5-14(9-16)11-19-7-2-1-3-8-19/h4-6,9,15H,1-3,7-8,10-13H2,(H2,18,22,23) |
| InChIKey | XOHKUXYUXZCATF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |