C15H21N3O3S — CID 168719381
5-oxo-1-[3-(pyrrolidin-1-ylmethyl)phenyl]pyrrolidine-3-sulfonamide (PubChem CID 168719381) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 5-oxo-1-[3-(pyrrolidin-1-ylmethyl)phenyl]pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-[3-(pyrrolidin-1-ylmethyl)phenyl]pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168719381 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-oxo-1-[3-(pyrrolidin-1-ylmethyl)phenyl]pyrrolidine-3-sulfonamide |
| SMILES | NS(=O)(=O)C1CC(=O)N(c2cccc(CN3CCCC3)c2)C1 |
| InChI | InChI=1S/C15H21N3O3S/c16-22(20,21)14-9-15(19)18(11-14)13-5-3-4-12(8-13)10-17-6-1-2-7-17/h3-5,8,14H,1-2,6-7,9-11H2,(H2,16,20,21) |
| InChIKey | CCNHFWXDAKBLPY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |