C12H16N2O4S — CID 168717122
1-(3-ethoxyphenyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168717122) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is 1-(3-ethoxyphenyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(3-ethoxyphenyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168717122 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-(3-ethoxyphenyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | CCOc1cccc(N2CC(S(N)(=O)=O)CC2=O)c1 |
| InChI | InChI=1S/C12H16N2O4S/c1-2-18-10-5-3-4-9(6-10)14-8-11(7-12(14)15)19(13,16)17/h3-6,11H,2,7-8H2,1H3,(H2,13,16,17) |
| InChIKey | JPBYKMISPIOKHP-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |