C15H21N3O4S — CID 168717035
N,N-diethyl-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzamide (PubChem CID 168717035) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N,N-diethyl-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzamide.
| Compound Name | N,N-diethyl-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzamide |
|---|---|
| PubChem CID | 168717035 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N,N-diethyl-3-(2-oxo-4-sulfamoylpyrrolidin-1-yl)benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(N2CC(S(N)(=O)=O)CC2=O)c1 |
| InChI | InChI=1S/C15H21N3O4S/c1-3-17(4-2)15(20)11-6-5-7-12(8-11)18-10-13(9-14(18)19)23(16,21)22/h5-8,13H,3-4,9-10H2,1-2H3,(H2,16,21,22) |
| InChIKey | ZGEISZJVMUCBNF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |