C14H17BrN2O2 — CID 168503934
3-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-N,N-dimethylbenzamide (PubChem CID 168503934) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 3-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-N,N-dimethylbenzamide.
| Compound Name | 3-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 168503934 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(N2CC(CBr)CC2=O)c1 |
| InChI | InChI=1S/C14H17BrN2O2/c1-16(2)14(19)11-4-3-5-12(7-11)17-9-10(8-15)6-13(17)18/h3-5,7,10H,6,8-9H2,1-2H3 |
| InChIKey | BHFUUVJNXCKODA-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|