C13H17N3O2 — CID 168699354
3-(4-amino-2-oxopyrrolidin-1-yl)-N,N-dimethylbenzamide (PubChem CID 168699354) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 3-(4-amino-2-oxopyrrolidin-1-yl)-N,N-dimethylbenzamide.
| Compound Name | 3-(4-amino-2-oxopyrrolidin-1-yl)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 168699354 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 3-(4-amino-2-oxopyrrolidin-1-yl)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(N2CC(N)CC2=O)c1 |
| InChI | InChI=1S/C13H17N3O2/c1-15(2)13(18)9-4-3-5-11(6-9)16-8-10(14)7-12(16)17/h3-6,10H,7-8,14H2,1-2H3 |
| InChIKey | CZYISOVWONHFGT-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |