C12H16N4O4S — CID 168683124
[1-[3-(hydrazinecarbonyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168683124) has the molecular formula C12H16N4O4S and a molecular weight of 312.35 g/mol. Its IUPAC name is [1-[3-(hydrazinecarbonyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-[3-(hydrazinecarbonyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168683124 |
| Molecular Formula | C12H16N4O4S |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [1-[3-(hydrazinecarbonyl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NNC(=O)c1cccc(N2CC(CS(N)(=O)=O)CC2=O)c1 |
| InChI | InChI=1S/C12H16N4O4S/c13-15-12(18)9-2-1-3-10(5-9)16-6-8(4-11(16)17)7-21(14,19)20/h1-3,5,8H,4,6-7,13H2,(H,15,18)(H2,14,19,20) |
| InChIKey | FNXFERNMDFKUTB-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|