C12H13N3O3S — CID 168683120
[1-(3-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168683120) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is [1-(3-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(3-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168683120 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | [1-(3-cyanophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | N#Cc1cccc(N2CC(CS(N)(=O)=O)CC2=O)c1 |
| InChI | InChI=1S/C12H13N3O3S/c13-6-9-2-1-3-11(4-9)15-7-10(5-12(15)16)8-19(14,17)18/h1-4,10H,5,7-8H2,(H2,14,17,18) |
| InChIKey | KFJLDLGVIUKWBD-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |