C14H15N3O5S — CID 168681036
methyl 2-cyano-4-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]benzoate (PubChem CID 168681036) has the molecular formula C14H15N3O5S and a molecular weight of 337.36 g/mol. Its IUPAC name is methyl 2-cyano-4-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]benzoate.
| Compound Name | methyl 2-cyano-4-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 168681036 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | methyl 2-cyano-4-[2-oxo-4-(sulfamoylmethyl)pyrrolidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2CC(CS(N)(=O)=O)CC2=O)cc1C#N |
| InChI | InChI=1S/C14H15N3O5S/c1-22-14(19)12-3-2-11(5-10(12)6-15)17-7-9(4-13(17)18)8-23(16,20)21/h2-3,5,9H,4,7-8H2,1H3,(H2,16,20,21) |
| InChIKey | NHZLPNHFIHVPCA-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |