C14H13ClN2O5S — CID 168672958
methyl 4-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-cyanobenzoate (PubChem CID 168672958) has the molecular formula C14H13ClN2O5S and a molecular weight of 356.79 g/mol. Its IUPAC name is methyl 4-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-cyanobenzoate.
| Compound Name | methyl 4-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-cyanobenzoate |
|---|---|
| PubChem CID | 168672958 |
| Molecular Formula | C14H13ClN2O5S |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | methyl 4-[4-(chlorosulfonylmethyl)-2-oxopyrrolidin-1-yl]-3-cyanobenzoate |
| SMILES | COC(=O)c1ccc(N2CC(CS(=O)(=O)Cl)CC2=O)c(C#N)c1 |
| InChI | InChI=1S/C14H13ClN2O5S/c1-22-14(19)10-2-3-12(11(5-10)6-16)17-7-9(4-13(17)18)8-23(15,20)21/h2-3,5,9H,4,7-8H2,1H3 |
| InChIKey | IPEHESODBRMONR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 104.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |