C12H10ClN3O5S — CID 168674167
[1-(2-cyano-4-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168674167) has the molecular formula C12H10ClN3O5S and a molecular weight of 343.75 g/mol. Its IUPAC name is [1-(2-cyano-4-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(2-cyano-4-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168674167 |
| Molecular Formula | C12H10ClN3O5S |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | [1-(2-cyano-4-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1N1CC(CS(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C12H10ClN3O5S/c13-22(20,21)7-8-3-12(17)15(6-8)11-2-1-10(16(18)19)4-9(11)5-14/h1-2,4,8H,3,6-7H2 |
| InChIKey | MIRDCRWKTWLZGR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|