C12H15N3O6S — CID 168682911
[1-[2-(hydroxymethyl)-5-nitrophenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682911) has the molecular formula C12H15N3O6S and a molecular weight of 329.33 g/mol. Its IUPAC name is [1-[2-(hydroxymethyl)-5-nitrophenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-[2-(hydroxymethyl)-5-nitrophenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682911 |
| Molecular Formula | C12H15N3O6S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | [1-[2-(hydroxymethyl)-5-nitrophenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2cc([N+](=O)[O-])ccc2CO)C1 |
| InChI | InChI=1S/C12H15N3O6S/c13-22(20,21)7-8-3-12(17)14(5-8)11-4-10(15(18)19)2-1-9(11)6-16/h1-2,4,8,16H,3,5-7H2,(H2,13,20,21) |
| InChIKey | JRAZVHQADFGFMT-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 143.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|