C11H11ClIN3O5S — CID 168682347
[1-(5-chloro-4-iodo-2-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682347) has the molecular formula C11H11ClIN3O5S and a molecular weight of 459.65 g/mol. Its IUPAC name is [1-(5-chloro-4-iodo-2-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(5-chloro-4-iodo-2-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682347 |
| Molecular Formula | C11H11ClIN3O5S |
| Molecular Weight | 459.65 g/mol |
| Exact Mass | 458.92 |
| IUPAC Name | [1-(5-chloro-4-iodo-2-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2cc(Cl)c(I)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C11H11ClIN3O5S/c12-7-2-9(10(16(18)19)3-8(7)13)15-4-6(1-11(15)17)5-22(14,20)21/h2-3,6H,1,4-5H2,(H2,14,20,21) |
| InChIKey | GLHVWHYJOAXMJB-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.65 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|