C10H11ClN4O5S — CID 168682809
[1-(6-chloro-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682809) has the molecular formula C10H11ClN4O5S and a molecular weight of 334.74 g/mol. Its IUPAC name is [1-(6-chloro-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(6-chloro-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682809 |
| Molecular Formula | C10H11ClN4O5S |
| Molecular Weight | 334.74 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | [1-(6-chloro-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2nc(Cl)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C10H11ClN4O5S/c11-8-2-1-7(15(17)18)10(13-8)14-4-6(3-9(14)16)5-21(12,19)20/h1-2,6H,3-5H2,(H2,12,19,20) |
| InChIKey | GKDHFTWPSDZYMU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 136.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.74 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|