C10H11Cl2N3O3S — CID 168683033
[1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168683033) has the molecular formula C10H11Cl2N3O3S and a molecular weight of 324.19 g/mol. Its IUPAC name is [1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168683033 |
| Molecular Formula | C10H11Cl2N3O3S |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 322.99 |
| IUPAC Name | [1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2cc(Cl)nc(Cl)c2)C1 |
| InChI | InChI=1S/C10H11Cl2N3O3S/c11-8-2-7(3-9(12)14-8)15-4-6(1-10(15)16)5-19(13,17)18/h2-3,6H,1,4-5H2,(H2,13,17,18) |
| InChIKey | DPKZKKYKLARLQH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|