C11H14N2O3S2 — CID 168682592
[5-oxo-1-(4-sulfanylphenyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682592) has the molecular formula C11H14N2O3S2 and a molecular weight of 286.38 g/mol. Its IUPAC name is [5-oxo-1-(4-sulfanylphenyl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [5-oxo-1-(4-sulfanylphenyl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682592 |
| Molecular Formula | C11H14N2O3S2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | [5-oxo-1-(4-sulfanylphenyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2ccc(S)cc2)C1 |
| InChI | InChI=1S/C11H14N2O3S2/c12-18(15,16)7-8-5-11(14)13(6-8)9-1-3-10(17)4-2-9/h1-4,8,17H,5-7H2,(H2,12,15,16) |
| InChIKey | HWRTXUVLVPVPSL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|