C15H18N4O3S — CID 168681755
[1-[4-(2-methylimidazol-1-yl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168681755) has the molecular formula C15H18N4O3S and a molecular weight of 334.40 g/mol. Its IUPAC name is [1-[4-(2-methylimidazol-1-yl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-[4-(2-methylimidazol-1-yl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168681755 |
| Molecular Formula | C15H18N4O3S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [1-[4-(2-methylimidazol-1-yl)phenyl]-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | Cc1nccn1-c1ccc(N2CC(CS(N)(=O)=O)CC2=O)cc1 |
| InChI | InChI=1S/C15H18N4O3S/c1-11-17-6-7-18(11)13-2-4-14(5-3-13)19-9-12(8-15(19)20)10-23(16,21)22/h2-7,12H,8-10H2,1H3,(H2,16,21,22) |
| InChIKey | KZWDPHARRXWLBI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |