C18H18N2O4S — CID 168682571
[1-(4-benzoylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682571) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is [1-(4-benzoylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(4-benzoylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682571 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [1-(4-benzoylphenyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2ccc(C(=O)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C18H18N2O4S/c19-25(23,24)12-13-10-17(21)20(11-13)16-8-6-15(7-9-16)18(22)14-4-2-1-3-5-14/h1-9,13H,10-12H2,(H2,19,23,24) |
| InChIKey | QYMQUMLUYJABNC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |