C16H18N4O3S — CID 168682606
[1-(6-anilino-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682606) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is [1-(6-anilino-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(6-anilino-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682606 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [1-(6-anilino-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2ccc(Nc3ccccc3)nc2)C1 |
| InChI | InChI=1S/C16H18N4O3S/c17-24(22,23)11-12-8-16(21)20(10-12)14-6-7-15(18-9-14)19-13-4-2-1-3-5-13/h1-7,9,12H,8,10-11H2,(H,18,19)(H2,17,22,23) |
| InChIKey | ICCBVRVBOMWQGU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |