C18H19N3O2S — CID 168668282
S-[[1-(6-anilino-3-pyridinyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168668282) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is S-[[1-(6-anilino-3-pyridinyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(6-anilino-3-pyridinyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168668282 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | S-[[1-(6-anilino-3-pyridinyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2ccc(Nc3ccccc3)nc2)C1 |
| InChI | InChI=1S/C18H19N3O2S/c1-13(22)24-12-14-9-18(23)21(11-14)16-7-8-17(19-10-16)20-15-5-3-2-4-6-15/h2-8,10,14H,9,11-12H2,1H3,(H,19,20) |
| InChIKey | NABAJGPFVXNLOL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|